About 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid
3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid (PubChem CID 107967062) has the molecular formula C8H6Cl2N4O2S
and a molecular weight of 293.14 g/mol. Its IUPAC name is 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid |
| PubChem CID | 107967062 |
| Molecular Formula | C8H6Cl2N4O2S |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1nnnc1-c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H6Cl2N4O2S/c9-5-3-4(7(10)17-5)8-11-12-13-14(8)2-1-6(15)16/h3H,1-2H2,(H,15,16) |
| InChIKey | PBEUPSOXYRIFHD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid?
The IUPAC name of 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid (CID 107967062) is 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid.
What is the SMILES notation for 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid?
The canonical SMILES for 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid is O=C(O)CCn1nnnc1-c1cc(Cl)sc1Cl.
What is the InChIKey of 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid?
The InChIKey is PBEUPSOXYRIFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N4O2S/c9-5-3-4(7(10)17-5)8-11-12-13-14(8)2-1-6(15)16/h3H,1-2H2,(H,15,16).
What are the key properties of 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid?
3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid has a molecular weight of 293.14 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid is sourced from PubChem (CID 107967062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).