About 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid
4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid (PubChem CID 107967079) has the molecular formula C10H10Cl2N4O2S
and a molecular weight of 321.19 g/mol. Its IUPAC name is 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid |
| PubChem CID | 107967079 |
| Molecular Formula | C10H10Cl2N4O2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)Cn1nnnc1-c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H10Cl2N4O2S/c1-5(2-8(17)18)4-16-10(13-14-15-16)6-3-7(11)19-9(6)12/h3,5H,2,4H2,1H3,(H,17,18) |
| InChIKey | MCCGTCPYIZMAON-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid?
The IUPAC name of 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid (CID 107967079) is 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid.
What is the SMILES notation for 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid?
The canonical SMILES for 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid is CC(CC(=O)O)Cn1nnnc1-c1cc(Cl)sc1Cl.
What is the InChIKey of 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid?
The InChIKey is MCCGTCPYIZMAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N4O2S/c1-5(2-8(17)18)4-16-10(13-14-15-16)6-3-7(11)19-9(6)12/h3,5H,2,4H2,1H3,(H,17,18).
What are the key properties of 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid?
4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid has a molecular weight of 321.19 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-3-methylbutanoic acid is sourced from PubChem (CID 107967079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).