C14H10Cl2N2O2S — CID 107967198
5-(2,5-dichlorothiophen-3-yl)-4-(3-methoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 107967198) has the molecular formula C14H10Cl2N2O2S and a molecular weight of 341.22 g/mol. Its IUPAC name is 5-(2,5-dichlorothiophen-3-yl)-4-(3-methoxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2,5-dichlorothiophen-3-yl)-4-(3-methoxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 107967198 |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 5-(2,5-dichlorothiophen-3-yl)-4-(3-methoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1cccc(-c2c(N)noc2-c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N2O2S/c1-19-8-4-2-3-7(5-8)11-12(20-18-14(11)17)9-6-10(15)21-13(9)16/h2-6H,1H3,(H2,17,18) |
| InChIKey | KTMBGHRNCZVDAJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |