About 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine
5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine (PubChem CID 107967222) has the molecular formula C7H4BrIN2OS
and a molecular weight of 371.00 g/mol. Its IUPAC name is 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine |
| PubChem CID | 107967222 |
| Molecular Formula | C7H4BrIN2OS |
| Molecular Weight | 371.00 g/mol |
| Exact Mass | 369.83 |
| IUPAC Name | 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2csc(Br)c2)c1I |
| InChI | InChI=1S/C7H4BrIN2OS/c8-4-1-3(2-13-4)6-5(9)7(10)11-12-6/h1-2H,(H2,10,11) |
| InChIKey | UKRZBQPHOKLGKD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.00 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine?
The IUPAC name of 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine (CID 107967222) is 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine?
The canonical SMILES for 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine is Nc1noc(-c2csc(Br)c2)c1I.
What is the InChIKey of 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine?
The InChIKey is UKRZBQPHOKLGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrIN2OS/c8-4-1-3(2-13-4)6-5(9)7(10)11-12-6/h1-2H,(H2,10,11).
What are the key properties of 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine?
5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine has a molecular weight of 371.00 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-bromothiophen-3-yl)-4-iodo-1,2-oxazol-3-amine is sourced from PubChem (CID 107967222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).