About (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile
(E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile (PubChem CID 107967399) has the molecular formula C7H4Cl2N2S
and a molecular weight of 219.10 g/mol. Its IUPAC name is (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile |
| PubChem CID | 107967399 |
| Molecular Formula | C7H4Cl2N2S |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile |
| SMILES | N#C/C=C(/N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H4Cl2N2S/c8-6-3-4(7(9)12-6)5(11)1-2-10/h1,3H,11H2/b5-1+ |
| InChIKey | LQICKXNCKPBLNJ-ORCRQEGFSA-N |
| XLogP | 2.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile?
The IUPAC name of (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile (CID 107967399) is (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile.
What is the SMILES notation for (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile?
The canonical SMILES for (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile is N#C/C=C(/N)c1cc(Cl)sc1Cl.
What is the InChIKey of (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile?
The InChIKey is LQICKXNCKPBLNJ-ORCRQEGFSA-N. The full InChI is InChI=1S/C7H4Cl2N2S/c8-6-3-4(7(9)12-6)5(11)1-2-10/h1,3H,11H2/b5-1+.
What are the key properties of (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile?
(E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile has a molecular weight of 219.10 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile is sourced from PubChem (CID 107967399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).