About [(3S)-5,5-dimethyloxolan-3-yl]methanol
[(3S)-5,5-dimethyloxolan-3-yl]methanol (PubChem CID 10796767) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is [(3S)-5,5-dimethyloxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-5,5-dimethyloxolan-3-yl]methanol |
| PubChem CID | 10796767 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | [(3S)-5,5-dimethyloxolan-3-yl]methanol |
| SMILES | CC1(C)C[C@@H](CO)CO1 |
| InChI | InChI=1S/C7H14O2/c1-7(2)3-6(4-8)5-9-7/h6,8H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | CNVRALIOWLIHEP-LURJTMIESA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S)-5,5-dimethyloxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5,5-dimethyloxolan-3-yl]methanol?
The IUPAC name of [(3S)-5,5-dimethyloxolan-3-yl]methanol (CID 10796767) is [(3S)-5,5-dimethyloxolan-3-yl]methanol.
What is the SMILES notation for [(3S)-5,5-dimethyloxolan-3-yl]methanol?
The canonical SMILES for [(3S)-5,5-dimethyloxolan-3-yl]methanol is CC1(C)C[C@@H](CO)CO1.
What is the InChIKey of [(3S)-5,5-dimethyloxolan-3-yl]methanol?
The InChIKey is CNVRALIOWLIHEP-LURJTMIESA-N. The full InChI is InChI=1S/C7H14O2/c1-7(2)3-6(4-8)5-9-7/h6,8H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of [(3S)-5,5-dimethyloxolan-3-yl]methanol?
[(3S)-5,5-dimethyloxolan-3-yl]methanol has a molecular weight of 130.19 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5,5-dimethyloxolan-3-yl]methanol is sourced from PubChem (CID 10796767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).