C7H10O3 — CID 10796850
(2S)-4-methoxy-2-methyl-2,3-dihydropyran-6-one (PubChem CID 10796850) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (2S)-4-methoxy-2-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S)-4-methoxy-2-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10796850 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (2S)-4-methoxy-2-methyl-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)O[C@@H](C)C1 |
| InChI | InChI=1S/C7H10O3/c1-5-3-6(9-2)4-7(8)10-5/h4-5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | TWJYJKOEWGZNIB-YFKPBYRVSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |