C16H14Br2N2S — CID 107968835
N-[(2,5-dibromothiophen-3-yl)-quinolin-7-ylmethyl]ethanamine (PubChem CID 107968835) has the molecular formula C16H14Br2N2S and a molecular weight of 426.18 g/mol. Its IUPAC name is N-[(2,5-dibromothiophen-3-yl)-quinolin-7-ylmethyl]ethanamine.
| Compound Name | N-[(2,5-dibromothiophen-3-yl)-quinolin-7-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 107968835 |
| Molecular Formula | C16H14Br2N2S |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 423.92 |
| IUPAC Name | N-[(2,5-dibromothiophen-3-yl)-quinolin-7-ylmethyl]ethanamine |
| SMILES | CCNC(c1ccc2cccnc2c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C16H14Br2N2S/c1-2-19-15(12-9-14(17)21-16(12)18)11-6-5-10-4-3-7-20-13(10)8-11/h3-9,15,19H,2H2,1H3 |
| InChIKey | YZIFXBIRZMIFJE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |