C12H13Br2NOS — CID 107968942
1-(2,5-dibromothiophen-3-yl)-N-ethyl-2-(furan-3-yl)ethanamine (PubChem CID 107968942) has the molecular formula C12H13Br2NOS and a molecular weight of 379.12 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-N-ethyl-2-(furan-3-yl)ethanamine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-N-ethyl-2-(furan-3-yl)ethanamine |
|---|---|
| PubChem CID | 107968942 |
| Molecular Formula | C12H13Br2NOS |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-N-ethyl-2-(furan-3-yl)ethanamine |
| SMILES | CCNC(Cc1ccoc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H13Br2NOS/c1-2-15-10(5-8-3-4-16-7-8)9-6-11(13)17-12(9)14/h3-4,6-7,10,15H,2,5H2,1H3 |
| InChIKey | YSWNPHRJPGDIJL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |