C13H10Cl2N4S — CID 107969139
(2,5-dichlorothiophen-3-yl)-(3-phenyltriazol-4-yl)methanamine (PubChem CID 107969139) has the molecular formula C13H10Cl2N4S and a molecular weight of 325.22 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(3-phenyltriazol-4-yl)methanamine.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(3-phenyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 107969139 |
| Molecular Formula | C13H10Cl2N4S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(3-phenyltriazol-4-yl)methanamine |
| SMILES | NC(c1cc(Cl)sc1Cl)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H10Cl2N4S/c14-11-6-9(13(15)20-11)12(16)10-7-17-18-19(10)8-4-2-1-3-5-8/h1-7,12H,16H2 |
| InChIKey | MYDSJQZBXYVNDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |