C9H6Cl2N2OS — CID 107969669
(2,5-dichlorothiophen-3-yl)-pyrazin-2-ylmethanol (PubChem CID 107969669) has the molecular formula C9H6Cl2N2OS and a molecular weight of 261.13 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-pyrazin-2-ylmethanol.
| Compound Name | (2,5-dichlorothiophen-3-yl)-pyrazin-2-ylmethanol |
|---|---|
| PubChem CID | 107969669 |
| Molecular Formula | C9H6Cl2N2OS |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-pyrazin-2-ylmethanol |
| SMILES | OC(c1cnccn1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H6Cl2N2OS/c10-7-3-5(9(11)15-7)8(14)6-4-12-1-2-13-6/h1-4,8,14H |
| InChIKey | GDIYKSZIDVYUIC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |