C8H7Br2N3OS — CID 107969905
(2,5-dibromothiophen-3-yl)-(3-methyltriazol-4-yl)methanol (PubChem CID 107969905) has the molecular formula C8H7Br2N3OS and a molecular weight of 353.04 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(3-methyltriazol-4-yl)methanol.
| Compound Name | (2,5-dibromothiophen-3-yl)-(3-methyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 107969905 |
| Molecular Formula | C8H7Br2N3OS |
| Molecular Weight | 353.04 g/mol |
| Exact Mass | 350.87 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(3-methyltriazol-4-yl)methanol |
| SMILES | Cn1nncc1C(O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C8H7Br2N3OS/c1-13-5(3-11-12-13)7(14)4-2-6(9)15-8(4)10/h2-3,7,14H,1H3 |
| InChIKey | FJWFGJVFXBHUOI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |