C14H12Cl2N2OS — CID 107970618
[(2,5-dichlorothiophen-3-yl)-(5-methyl-1-benzofuran-2-yl)methyl]hydrazine (PubChem CID 107970618) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is [(2,5-dichlorothiophen-3-yl)-(5-methyl-1-benzofuran-2-yl)methyl]hydrazine.
| Compound Name | [(2,5-dichlorothiophen-3-yl)-(5-methyl-1-benzofuran-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107970618 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | [(2,5-dichlorothiophen-3-yl)-(5-methyl-1-benzofuran-2-yl)methyl]hydrazine |
| SMILES | Cc1ccc2oc(C(NN)c3cc(Cl)sc3Cl)cc2c1 |
| InChI | InChI=1S/C14H12Cl2N2OS/c1-7-2-3-10-8(4-7)5-11(19-10)13(18-17)9-6-12(15)20-14(9)16/h2-6,13,18H,17H2,1H3 |
| InChIKey | AMSDAECZGCGMHI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|