C14H9Br2N3O — CID 107971053
N-(2-amino-4-cyanophenyl)-3,5-dibromobenzamide (PubChem CID 107971053) has the molecular formula C14H9Br2N3O and a molecular weight of 395.05 g/mol. Its IUPAC name is N-(2-amino-4-cyanophenyl)-3,5-dibromobenzamide.
| Compound Name | N-(2-amino-4-cyanophenyl)-3,5-dibromobenzamide |
|---|---|
| PubChem CID | 107971053 |
| Molecular Formula | C14H9Br2N3O |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | N-(2-amino-4-cyanophenyl)-3,5-dibromobenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Br)cc(Br)c2)c(N)c1 |
| InChI | InChI=1S/C14H9Br2N3O/c15-10-4-9(5-11(16)6-10)14(20)19-13-2-1-8(7-17)3-12(13)18/h1-6H,18H2,(H,19,20) |
| InChIKey | HXYAWCAIVQKVEY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|