C10H14N6O — CID 107971078
N-[2-(4-aminopyrazol-1-yl)ethyl]-1-methylimidazole-4-carboxamide (PubChem CID 107971078) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 107971078 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-1-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C(=O)NCCn2cc(N)cn2)c1 |
| InChI | InChI=1S/C10H14N6O/c1-15-6-9(13-7-15)10(17)12-2-3-16-5-8(11)4-14-16/h4-7H,2-3,11H2,1H3,(H,12,17) |
| InChIKey | NKZUIZPRYXGVHZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |