About 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine
5-thiophen-2-yl-1H-1,2,4-triazol-3-amine (PubChem CID 10797134) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 10797134 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2cccs2)n1 |
| InChI | InChI=1S/C6H6N4S/c7-6-8-5(9-10-6)4-2-1-3-11-4/h1-3H,(H3,7,8,9,10) |
| InChIKey | XMLRXJVRTGHHIJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine (CID 10797134) is 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine is Nc1n[nH]c(-c2cccs2)n1.
What is the InChIKey of 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine?
The InChIKey is XMLRXJVRTGHHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c7-6-8-5(9-10-6)4-2-1-3-11-4/h1-3H,(H3,7,8,9,10).
What are the key properties of 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine?
5-thiophen-2-yl-1H-1,2,4-triazol-3-amine has a molecular weight of 166.21 g/mol, XLogP of 1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thiophen-2-yl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 10797134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).