About N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine
N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 107971995) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 107971995 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNCc1cn(C)cn1 |
| InChI | InChI=1S/C10H20N4/c1-9(2)12-5-4-11-6-10-7-14(3)8-13-10/h7-9,11-12H,4-6H2,1-3H3 |
| InChIKey | PTISUCYZLRRONM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine (CID 107971995) is N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine is CC(C)NCCNCc1cn(C)cn1.
What is the InChIKey of N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is PTISUCYZLRRONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-9(2)12-5-4-11-6-10-7-14(3)8-13-10/h7-9,11-12H,4-6H2,1-3H3.
What are the key properties of N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine?
N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 196.30 g/mol, XLogP of 0.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-methylimidazol-4-yl)methyl]-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 107971995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).