C13H8Br2ClNO2 — CID 107972808
3,5-dibromo-N-(3-chloro-4-hydroxyphenyl)benzamide (PubChem CID 107972808) has the molecular formula C13H8Br2ClNO2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 3,5-dibromo-N-(3-chloro-4-hydroxyphenyl)benzamide.
| Compound Name | 3,5-dibromo-N-(3-chloro-4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 107972808 |
| Molecular Formula | C13H8Br2ClNO2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | 3,5-dibromo-N-(3-chloro-4-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H8Br2ClNO2/c14-8-3-7(4-9(15)5-8)13(19)17-10-1-2-12(18)11(16)6-10/h1-6,18H,(H,17,19) |
| InChIKey | CEBRXHCACWQQLK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|