C17H18Br2ClN — CID 107973808
N-[2-(2-chlorophenyl)-1-(3,5-dibromophenyl)ethyl]propan-1-amine (PubChem CID 107973808) has the molecular formula C17H18Br2ClN and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-1-(3,5-dibromophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-chlorophenyl)-1-(3,5-dibromophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107973808 |
| Molecular Formula | C17H18Br2ClN |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | N-[2-(2-chlorophenyl)-1-(3,5-dibromophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccccc1Cl)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C17H18Br2ClN/c1-2-7-21-17(10-12-5-3-4-6-16(12)20)13-8-14(18)11-15(19)9-13/h3-6,8-9,11,17,21H,2,7,10H2,1H3 |
| InChIKey | GNYGUZPEDMKIGV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |