About 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol
2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol (PubChem CID 10797411) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol |
| PubChem CID | 10797411 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(/C=C\CO)c(O)c1 |
| InChI | InChI=1S/C11H14O2/c1-8-6-9(2)10(4-3-5-12)11(13)7-8/h3-4,6-7,12-13H,5H2,1-2H3/b4-3- |
| InChIKey | BLSSRPRVSJONQR-ARJAWSKDSA-N |
| XLogP | 2.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol?
The IUPAC name of 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol (CID 10797411) is 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol.
What is the SMILES notation for 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol?
The canonical SMILES for 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol is Cc1cc(C)c(/C=C\CO)c(O)c1.
What is the InChIKey of 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol?
The InChIKey is BLSSRPRVSJONQR-ARJAWSKDSA-N. The full InChI is InChI=1S/C11H14O2/c1-8-6-9(2)10(4-3-5-12)11(13)7-8/h3-4,6-7,12-13H,5H2,1-2H3/b4-3-.
What are the key properties of 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol?
2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol has a molecular weight of 178.23 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3-hydroxyprop-1-enyl]-3,5-dimethylphenol is sourced from PubChem (CID 10797411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).