About 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole
2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 10797419) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
Analyze 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The IUPAC name of 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole (CID 10797419) is 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
What is the SMILES notation for 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The canonical SMILES for 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole is CCc1nc2c(CC)c(C)[nH]n2n1.
What is the InChIKey of 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The InChIKey is VSHMGCQNPLNLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-4-7-6(3)11-13-9(7)10-8(5-2)12-13/h11H,4-5H2,1-3H3.
What are the key properties of 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole has a molecular weight of 178.24 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diethyl-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazole is sourced from PubChem (CID 10797419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).