C11H15N3S — CID 107974380
N-methyl-1-(1-methylimidazol-4-yl)-2-thiophen-2-ylethanamine (PubChem CID 107974380) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N-methyl-1-(1-methylimidazol-4-yl)-2-thiophen-2-ylethanamine.
| Compound Name | N-methyl-1-(1-methylimidazol-4-yl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 107974380 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-methyl-1-(1-methylimidazol-4-yl)-2-thiophen-2-ylethanamine |
| SMILES | CNC(Cc1cccs1)c1cn(C)cn1 |
| InChI | InChI=1S/C11H15N3S/c1-12-10(6-9-4-3-5-15-9)11-7-14(2)8-13-11/h3-5,7-8,10,12H,6H2,1-2H3 |
| InChIKey | GMDMPCYAEJYLHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |