C13H15Br2N3O2 — CID 107974498
1-[5-(3,5-dibromophenyl)-1,2,4-oxadiazol-3-yl]-2-propoxyethanamine (PubChem CID 107974498) has the molecular formula C13H15Br2N3O2 and a molecular weight of 405.09 g/mol. Its IUPAC name is 1-[5-(3,5-dibromophenyl)-1,2,4-oxadiazol-3-yl]-2-propoxyethanamine.
| Compound Name | 1-[5-(3,5-dibromophenyl)-1,2,4-oxadiazol-3-yl]-2-propoxyethanamine |
|---|---|
| PubChem CID | 107974498 |
| Molecular Formula | C13H15Br2N3O2 |
| Molecular Weight | 405.09 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 1-[5-(3,5-dibromophenyl)-1,2,4-oxadiazol-3-yl]-2-propoxyethanamine |
| SMILES | CCCOCC(N)c1noc(-c2cc(Br)cc(Br)c2)n1 |
| InChI | InChI=1S/C13H15Br2N3O2/c1-2-3-19-7-11(16)12-17-13(20-18-12)8-4-9(14)6-10(15)5-8/h4-6,11H,2-3,7,16H2,1H3 |
| InChIKey | BKXCYRHVEURDTF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.09 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|