C10H12BrN3S — CID 107974649
2-(3-bromothiophen-2-yl)-1-(1-methylimidazol-4-yl)ethanamine (PubChem CID 107974649) has the molecular formula C10H12BrN3S and a molecular weight of 286.20 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(1-methylimidazol-4-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(1-methylimidazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107974649 |
| Molecular Formula | C10H12BrN3S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(1-methylimidazol-4-yl)ethanamine |
| SMILES | Cn1cnc(C(N)Cc2sccc2Br)c1 |
| InChI | InChI=1S/C10H12BrN3S/c1-14-5-9(13-6-14)8(12)4-10-7(11)2-3-15-10/h2-3,5-6,8H,4,12H2,1H3 |
| InChIKey | LDIKJVBMSNQSCH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |