C12H8Br2N4 — CID 107974678
3-(3,5-dibromophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 107974678) has the molecular formula C12H8Br2N4 and a molecular weight of 368.03 g/mol. Its IUPAC name is 3-(3,5-dibromophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-(3,5-dibromophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 107974678 |
| Molecular Formula | C12H8Br2N4 |
| Molecular Weight | 368.03 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 3-(3,5-dibromophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | Nc1ccc2nnc(-c3cc(Br)cc(Br)c3)n2c1 |
| InChI | InChI=1S/C12H8Br2N4/c13-8-3-7(4-9(14)5-8)12-17-16-11-2-1-10(15)6-18(11)12/h1-6H,15H2 |
| InChIKey | WRKLVBMTXZVWLX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.03 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |