C11H12Br2ClNO — CID 107975285
3,5-dibromo-N-(2-chlorobutyl)benzamide (PubChem CID 107975285) has the molecular formula C11H12Br2ClNO and a molecular weight of 369.48 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-chlorobutyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-chlorobutyl)benzamide |
|---|---|
| PubChem CID | 107975285 |
| Molecular Formula | C11H12Br2ClNO |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 366.90 |
| IUPAC Name | 3,5-dibromo-N-(2-chlorobutyl)benzamide |
| SMILES | CCC(Cl)CNC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H12Br2ClNO/c1-2-10(14)6-15-11(16)7-3-8(12)5-9(13)4-7/h3-5,10H,2,6H2,1H3,(H,15,16) |
| InChIKey | DCSJPTGJYJILMI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|