About 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine
4-(3-ethoxybuta-1,3-dien-2-yl)morpholine (PubChem CID 10797546) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine |
| PubChem CID | 10797546 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine |
| SMILES | C=C(OCC)C(=C)N1CCOCC1 |
| InChI | InChI=1S/C10H17NO2/c1-4-13-10(3)9(2)11-5-7-12-8-6-11/h2-8H2,1H3 |
| InChIKey | FSCHYIOCOVECIO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine?
The IUPAC name of 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine (CID 10797546) is 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine.
What is the SMILES notation for 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine?
The canonical SMILES for 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine is C=C(OCC)C(=C)N1CCOCC1.
What is the InChIKey of 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine?
The InChIKey is FSCHYIOCOVECIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-4-13-10(3)9(2)11-5-7-12-8-6-11/h2-8H2,1H3.
What are the key properties of 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine?
4-(3-ethoxybuta-1,3-dien-2-yl)morpholine has a molecular weight of 183.25 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethoxybuta-1,3-dien-2-yl)morpholine is sourced from PubChem (CID 10797546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).