C16H14Br2O3 — CID 107977350
(3,5-dibromophenyl)-[2-(2-methoxyethoxy)phenyl]methanone (PubChem CID 107977350) has the molecular formula C16H14Br2O3 and a molecular weight of 414.09 g/mol. Its IUPAC name is (3,5-dibromophenyl)-[2-(2-methoxyethoxy)phenyl]methanone.
| Compound Name | (3,5-dibromophenyl)-[2-(2-methoxyethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 107977350 |
| Molecular Formula | C16H14Br2O3 |
| Molecular Weight | 414.09 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | (3,5-dibromophenyl)-[2-(2-methoxyethoxy)phenyl]methanone |
| SMILES | COCCOc1ccccc1C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C16H14Br2O3/c1-20-6-7-21-15-5-3-2-4-14(15)16(19)11-8-12(17)10-13(18)9-11/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | WNUUKSWRDQLWJP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|