C13H23N3O — CID 107978055
N-[(1-methylimidazol-4-yl)-(oxan-3-yl)methyl]propan-1-amine (PubChem CID 107978055) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N-[(1-methylimidazol-4-yl)-(oxan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(1-methylimidazol-4-yl)-(oxan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107978055 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-[(1-methylimidazol-4-yl)-(oxan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cn(C)cn1)C1CCCOC1 |
| InChI | InChI=1S/C13H23N3O/c1-3-6-14-13(11-5-4-7-17-9-11)12-8-16(2)10-15-12/h8,10-11,13-14H,3-7,9H2,1-2H3 |
| InChIKey | JWSMXGHJHICIBH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |