About 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole
5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole (PubChem CID 10797836) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole |
| PubChem CID | 10797836 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole |
| SMILES | Cc1cc(Cc2cnc[nH]2)c(C)s1 |
| InChI | InChI=1S/C10H12N2S/c1-7-3-9(8(2)13-7)4-10-5-11-6-12-10/h3,5-6H,4H2,1-2H3,(H,11,12) |
| InChIKey | GDSOYSZXNMRHKH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole?
The IUPAC name of 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole (CID 10797836) is 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole.
What is the SMILES notation for 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole?
The canonical SMILES for 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole is Cc1cc(Cc2cnc[nH]2)c(C)s1.
What is the InChIKey of 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole?
The InChIKey is GDSOYSZXNMRHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-7-3-9(8(2)13-7)4-10-5-11-6-12-10/h3,5-6H,4H2,1-2H3,(H,11,12).
What are the key properties of 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole?
5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole has a molecular weight of 192.29 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylthiophen-3-yl)methyl]-1H-imidazole is sourced from PubChem (CID 10797836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).