C16H16Br2O2 — CID 107978570
(3,5-dibromophenyl)-(2-propan-2-yloxyphenyl)methanol (PubChem CID 107978570) has the molecular formula C16H16Br2O2 and a molecular weight of 400.11 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(2-propan-2-yloxyphenyl)methanol.
| Compound Name | (3,5-dibromophenyl)-(2-propan-2-yloxyphenyl)methanol |
|---|---|
| PubChem CID | 107978570 |
| Molecular Formula | C16H16Br2O2 |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | (3,5-dibromophenyl)-(2-propan-2-yloxyphenyl)methanol |
| SMILES | CC(C)Oc1ccccc1C(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C16H16Br2O2/c1-10(2)20-15-6-4-3-5-14(15)16(19)11-7-12(17)9-13(18)8-11/h3-10,16,19H,1-2H3 |
| InChIKey | VNMKFXVQUBVPLU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |