About (3-amino-2,4,6-trimethylphenyl) acetate
(3-amino-2,4,6-trimethylphenyl) acetate (PubChem CID 10797860) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (3-amino-2,4,6-trimethylphenyl) acetate.
Molecular Properties
| Compound Name | (3-amino-2,4,6-trimethylphenyl) acetate |
| PubChem CID | 10797860 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3-amino-2,4,6-trimethylphenyl) acetate |
| SMILES | CC(=O)Oc1c(C)cc(C)c(N)c1C |
| InChI | InChI=1S/C11H15NO2/c1-6-5-7(2)11(14-9(4)13)8(3)10(6)12/h5H,12H2,1-4H3 |
| InChIKey | QETLPDRIQFUMCD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-2,4,6-trimethylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2,4,6-trimethylphenyl) acetate?
The IUPAC name of (3-amino-2,4,6-trimethylphenyl) acetate (CID 10797860) is (3-amino-2,4,6-trimethylphenyl) acetate.
What is the SMILES notation for (3-amino-2,4,6-trimethylphenyl) acetate?
The canonical SMILES for (3-amino-2,4,6-trimethylphenyl) acetate is CC(=O)Oc1c(C)cc(C)c(N)c1C.
What is the InChIKey of (3-amino-2,4,6-trimethylphenyl) acetate?
The InChIKey is QETLPDRIQFUMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-6-5-7(2)11(14-9(4)13)8(3)10(6)12/h5H,12H2,1-4H3.
What are the key properties of (3-amino-2,4,6-trimethylphenyl) acetate?
(3-amino-2,4,6-trimethylphenyl) acetate has a molecular weight of 193.25 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2,4,6-trimethylphenyl) acetate is sourced from PubChem (CID 10797860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).