C13H20Br2N2 — CID 107978976
1-(3,5-dibromophenyl)heptylhydrazine (PubChem CID 107978976) has the molecular formula C13H20Br2N2 and a molecular weight of 364.13 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)heptylhydrazine.
| Compound Name | 1-(3,5-dibromophenyl)heptylhydrazine |
|---|---|
| PubChem CID | 107978976 |
| Molecular Formula | C13H20Br2N2 |
| Molecular Weight | 364.13 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1-(3,5-dibromophenyl)heptylhydrazine |
| SMILES | CCCCCCC(NN)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H20Br2N2/c1-2-3-4-5-6-13(17-16)10-7-11(14)9-12(15)8-10/h7-9,13,17H,2-6,16H2,1H3 |
| InChIKey | ZTXBUTACUBIAEX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.13 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|