C8H9N3O3 — CID 10797910
3-methoxy-6-methyl-1,4-dihydropyrrolo[3,4-c]pyridazine-5,7-dione (PubChem CID 10797910) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 3-methoxy-6-methyl-1,4-dihydropyrrolo[3,4-c]pyridazine-5,7-dione.
| Compound Name | 3-methoxy-6-methyl-1,4-dihydropyrrolo[3,4-c]pyridazine-5,7-dione |
|---|---|
| PubChem CID | 10797910 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-methoxy-6-methyl-1,4-dihydropyrrolo[3,4-c]pyridazine-5,7-dione |
| SMILES | COC1=NNC2=C(C1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C8H9N3O3/c1-11-7(12)4-3-5(14-2)9-10-6(4)8(11)13/h10H,3H2,1-2H3 |
| InChIKey | CUKBRJAZBHGNMY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|