C12H20O2 — CID 10797957
(3aS,6aR)-5-hexyl-3a,4,5,6a-tetrahydrofuro[2,3-b]furan (PubChem CID 10797957) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3aS,6aR)-5-hexyl-3a,4,5,6a-tetrahydrofuro[2,3-b]furan.
| Compound Name | (3aS,6aR)-5-hexyl-3a,4,5,6a-tetrahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 10797957 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3aS,6aR)-5-hexyl-3a,4,5,6a-tetrahydrofuro[2,3-b]furan |
| SMILES | CCCCCCC1C[C@H]2C=CO[C@H]2O1 |
| InChI | InChI=1S/C12H20O2/c1-2-3-4-5-6-11-9-10-7-8-13-12(10)14-11/h7-8,10-12H,2-6,9H2,1H3/t10-,11?,12+/m1/s1 |
| InChIKey | HJQLXPVYELWZPL-LWALXPGCSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|