C15H13Br2ClN2O — CID 107980200
3,5-dibromo-N-[3-chloro-2-(dimethylamino)phenyl]benzamide (PubChem CID 107980200) has the molecular formula C15H13Br2ClN2O and a molecular weight of 432.54 g/mol. Its IUPAC name is 3,5-dibromo-N-[3-chloro-2-(dimethylamino)phenyl]benzamide.
| Compound Name | 3,5-dibromo-N-[3-chloro-2-(dimethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 107980200 |
| Molecular Formula | C15H13Br2ClN2O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 429.91 |
| IUPAC Name | 3,5-dibromo-N-[3-chloro-2-(dimethylamino)phenyl]benzamide |
| SMILES | CN(C)c1c(Cl)cccc1NC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H13Br2ClN2O/c1-20(2)14-12(18)4-3-5-13(14)19-15(21)9-6-10(16)8-11(17)7-9/h3-8H,1-2H3,(H,19,21) |
| InChIKey | OMWCZRVJGBFZIL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |