C16H15Br2NOS — CID 107980230
3,5-dibromo-N-[1-(4-methylsulfanylphenyl)ethyl]benzamide (PubChem CID 107980230) has the molecular formula C16H15Br2NOS and a molecular weight of 429.18 g/mol. Its IUPAC name is 3,5-dibromo-N-[1-(4-methylsulfanylphenyl)ethyl]benzamide.
| Compound Name | 3,5-dibromo-N-[1-(4-methylsulfanylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 107980230 |
| Molecular Formula | C16H15Br2NOS |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 3,5-dibromo-N-[1-(4-methylsulfanylphenyl)ethyl]benzamide |
| SMILES | CSc1ccc(C(C)NC(=O)c2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C16H15Br2NOS/c1-10(11-3-5-15(21-2)6-4-11)19-16(20)12-7-13(17)9-14(18)8-12/h3-10H,1-2H3,(H,19,20) |
| InChIKey | IKNMAATTYZOJIL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |