C16H14Br2FNO — CID 107980294
3,5-dibromo-N-[1-(2-fluorophenyl)ethyl]-N-methylbenzamide (PubChem CID 107980294) has the molecular formula C16H14Br2FNO and a molecular weight of 415.10 g/mol. Its IUPAC name is 3,5-dibromo-N-[1-(2-fluorophenyl)ethyl]-N-methylbenzamide.
| Compound Name | 3,5-dibromo-N-[1-(2-fluorophenyl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 107980294 |
| Molecular Formula | C16H14Br2FNO |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 3,5-dibromo-N-[1-(2-fluorophenyl)ethyl]-N-methylbenzamide |
| SMILES | CC(c1ccccc1F)N(C)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C16H14Br2FNO/c1-10(14-5-3-4-6-15(14)19)20(2)16(21)11-7-12(17)9-13(18)8-11/h3-10H,1-2H3 |
| InChIKey | QAKAXOANNQNWJF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |