About (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile
(Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile (PubChem CID 107980671) has the molecular formula C10H6Br2ClN
and a molecular weight of 335.43 g/mol. Its IUPAC name is (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile |
| PubChem CID | 107980671 |
| Molecular Formula | C10H6Br2ClN |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 332.86 |
| IUPAC Name | (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile |
| SMILES | C/C(C#N)=C(/Cl)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H6Br2ClN/c1-6(5-14)10(13)7-2-8(11)4-9(12)3-7/h2-4H,1H3/b10-6- |
| InChIKey | XJTHMUKVYFQZEC-POHAHGRESA-N |
| XLogP | 4.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile?
The IUPAC name of (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile (CID 107980671) is (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile.
What is the SMILES notation for (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile?
The canonical SMILES for (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile is C/C(C#N)=C(/Cl)c1cc(Br)cc(Br)c1.
What is the InChIKey of (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile?
The InChIKey is XJTHMUKVYFQZEC-POHAHGRESA-N. The full InChI is InChI=1S/C10H6Br2ClN/c1-6(5-14)10(13)7-2-8(11)4-9(12)3-7/h2-4H,1H3/b10-6-.
What are the key properties of (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile?
(Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile has a molecular weight of 335.43 g/mol, XLogP of 4.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-chloro-3-(3,5-dibromophenyl)-2-methylprop-2-enenitrile is sourced from PubChem (CID 107980671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).