About (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol
(1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol (PubChem CID 10798102) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| PubChem CID | 10798102 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| SMILES | CC1=NO[C@@H]([C@@H](O)CNC(C)(C)C)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-7-5-9(14-12-7)8(13)6-11-10(2,3)4/h8-9,11,13H,5-6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | COZCJLWTRWBPOA-DTWKUNHWSA-N |
| XLogP | 0.90 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
The IUPAC name of (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol (CID 10798102) is (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
What is the SMILES notation for (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
The canonical SMILES for (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol is CC1=NO[C@@H]([C@@H](O)CNC(C)(C)C)C1.
What is the InChIKey of (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
The InChIKey is COZCJLWTRWBPOA-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-7-5-9(14-12-7)8(13)6-11-10(2,3)4/h8-9,11,13H,5-6H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol?
(1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol has a molecular weight of 200.28 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-(tert-butylamino)-1-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol is sourced from PubChem (CID 10798102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).