C17H19Br2NO — CID 107981150
3-amino-1-(3,5-dibromophenyl)-2-(3,4-dimethylphenyl)propan-1-ol (PubChem CID 107981150) has the molecular formula C17H19Br2NO and a molecular weight of 413.15 g/mol. Its IUPAC name is 3-amino-1-(3,5-dibromophenyl)-2-(3,4-dimethylphenyl)propan-1-ol.
| Compound Name | 3-amino-1-(3,5-dibromophenyl)-2-(3,4-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 107981150 |
| Molecular Formula | C17H19Br2NO |
| Molecular Weight | 413.15 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 3-amino-1-(3,5-dibromophenyl)-2-(3,4-dimethylphenyl)propan-1-ol |
| SMILES | Cc1ccc(C(CN)C(O)c2cc(Br)cc(Br)c2)cc1C |
| InChI | InChI=1S/C17H19Br2NO/c1-10-3-4-12(5-11(10)2)16(9-20)17(21)13-6-14(18)8-15(19)7-13/h3-8,16-17,21H,9,20H2,1-2H3 |
| InChIKey | DIQWEMKCYWNLKW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.15 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |