C11H16LiNO2 — CID 10798120
lithium tert-butyl 4-methyl-2,4-dihydropyridin-2-ide-1-carboxylate (PubChem CID 10798120) has the molecular formula C11H16LiNO2 and a molecular weight of 201.19 g/mol. Its IUPAC name is lithium tert-butyl 4-methyl-2,4-dihydropyridin-2-ide-1-carboxylate.
| Compound Name | lithium tert-butyl 4-methyl-2,4-dihydropyridin-2-ide-1-carboxylate |
|---|---|
| PubChem CID | 10798120 |
| Molecular Formula | C11H16LiNO2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | lithium tert-butyl 4-methyl-2,4-dihydropyridin-2-ide-1-carboxylate |
| SMILES | CC1C=[C-]N(C(=O)OC(C)(C)C)C=C1.[Li+] |
| InChI | InChI=1S/C11H16NO2.Li/c1-9-5-7-12(8-6-9)10(13)14-11(2,3)4;/h5-7,9H,1-4H3;/q-1;+1 |
| InChIKey | ISLMSOQNNCLBMQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|