About (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile
(2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile (PubChem CID 107981277) has the molecular formula C11H10Br2N2
and a molecular weight of 330.02 g/mol. Its IUPAC name is (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile.
Molecular Properties
| Compound Name | (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile |
| PubChem CID | 107981277 |
| Molecular Formula | C11H10Br2N2 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 327.92 |
| IUPAC Name | (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile |
| SMILES | CC/C(C#N)=C(/N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H10Br2N2/c1-2-7(6-14)11(15)8-3-9(12)5-10(13)4-8/h3-5H,2,15H2,1H3/b11-7- |
| InChIKey | WBVAELKPOOVBFK-XFFZJAGNSA-N |
| XLogP | 3.81 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile?
The IUPAC name of (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile (CID 107981277) is (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile.
What is the SMILES notation for (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile?
The canonical SMILES for (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile is CC/C(C#N)=C(/N)c1cc(Br)cc(Br)c1.
What is the InChIKey of (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile?
The InChIKey is WBVAELKPOOVBFK-XFFZJAGNSA-N. The full InChI is InChI=1S/C11H10Br2N2/c1-2-7(6-14)11(15)8-3-9(12)5-10(13)4-8/h3-5H,2,15H2,1H3/b11-7-.
What are the key properties of (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile?
(2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile has a molecular weight of 330.02 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[amino-(3,5-dibromophenyl)methylidene]butanenitrile is sourced from PubChem (CID 107981277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).