About 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid
2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid (PubChem CID 10798232) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid |
| PubChem CID | 10798232 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid |
| SMILES | CCOC1CSC(C(=O)O)=C(C)O1 |
| InChI | InChI=1S/C8H12O4S/c1-3-11-6-4-13-7(8(9)10)5(2)12-6/h6H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | IEPZTFVYHFLQRN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid?
The IUPAC name of 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid (CID 10798232) is 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid.
What is the SMILES notation for 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid?
The canonical SMILES for 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid is CCOC1CSC(C(=O)O)=C(C)O1.
What is the InChIKey of 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid?
The InChIKey is IEPZTFVYHFLQRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c1-3-11-6-4-13-7(8(9)10)5(2)12-6/h6H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid?
2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid has a molecular weight of 204.25 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-methyl-2,3-dihydro-1,4-oxathiine-5-carboxylic acid is sourced from PubChem (CID 10798232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).