C17H17BrFNO — CID 107982449
2-bromo-N-[1-(4-fluorophenyl)ethyl]-N,3-dimethylbenzamide (PubChem CID 107982449) has the molecular formula C17H17BrFNO and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-bromo-N-[1-(4-fluorophenyl)ethyl]-N,3-dimethylbenzamide.
| Compound Name | 2-bromo-N-[1-(4-fluorophenyl)ethyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 107982449 |
| Molecular Formula | C17H17BrFNO |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-bromo-N-[1-(4-fluorophenyl)ethyl]-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)C(C)c2ccc(F)cc2)c1Br |
| InChI | InChI=1S/C17H17BrFNO/c1-11-5-4-6-15(16(11)18)17(21)20(3)12(2)13-7-9-14(19)10-8-13/h4-10,12H,1-3H3 |
| InChIKey | FUGIHNXIJHIYRU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |