About propan-2-yl 2-phenylbutanoate
propan-2-yl 2-phenylbutanoate (PubChem CID 10798333) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is propan-2-yl 2-phenylbutanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-phenylbutanoate |
| PubChem CID | 10798333 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | propan-2-yl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-4-12(13(14)15-10(2)3)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3 |
| InChIKey | CNFICIURFRWLFF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-phenylbutanoate?
The IUPAC name of propan-2-yl 2-phenylbutanoate (CID 10798333) is propan-2-yl 2-phenylbutanoate.
What is the SMILES notation for propan-2-yl 2-phenylbutanoate?
The canonical SMILES for propan-2-yl 2-phenylbutanoate is CCC(C(=O)OC(C)C)c1ccccc1.
What is the InChIKey of propan-2-yl 2-phenylbutanoate?
The InChIKey is CNFICIURFRWLFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-4-12(13(14)15-10(2)3)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3.
What are the key properties of propan-2-yl 2-phenylbutanoate?
propan-2-yl 2-phenylbutanoate has a molecular weight of 206.28 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-phenylbutanoate is sourced from PubChem (CID 10798333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).