C12H18BrN — CID 107984713
N-[1-(2-bromo-3-methylphenyl)ethyl]propan-1-amine (PubChem CID 107984713) has the molecular formula C12H18BrN and a molecular weight of 256.19 g/mol. Its IUPAC name is N-[1-(2-bromo-3-methylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-bromo-3-methylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107984713 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[1-(2-bromo-3-methylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cccc(C)c1Br |
| InChI | InChI=1S/C12H18BrN/c1-4-8-14-10(3)11-7-5-6-9(2)12(11)13/h5-7,10,14H,4,8H2,1-3H3 |
| InChIKey | LUFZQUHYUGYEAR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |