C12H18O3 — CID 10798507
(1R,4S,7S)-7-(2,2-dimethoxyethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one (PubChem CID 10798507) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1R,4S,7S)-7-(2,2-dimethoxyethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one.
| Compound Name | (1R,4S,7S)-7-(2,2-dimethoxyethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one |
|---|---|
| PubChem CID | 10798507 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1R,4S,7S)-7-(2,2-dimethoxyethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one |
| SMILES | COC(C[C@H]1[C@@H]2C=C[C@@]1(C)C(=O)C2)OC |
| InChI | InChI=1S/C12H18O3/c1-12-5-4-8(6-10(12)13)9(12)7-11(14-2)15-3/h4-5,8-9,11H,6-7H2,1-3H3/t8-,9+,12-/m1/s1 |
| InChIKey | FFFFMRBLUPCYDY-VDDIYKPWSA-N |
| XLogP | 1.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|