C11H16O4 — CID 10798583
[(2S,3R,6R)-2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 10798583) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is [(2S,3R,6R)-2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2S,3R,6R)-2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 10798583 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [(2S,3R,6R)-2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | C=CCO[C@H]1C=C[C@@H](OC(C)=O)[C@H](C)O1 |
| InChI | InChI=1S/C11H16O4/c1-4-7-13-11-6-5-10(8(2)14-11)15-9(3)12/h4-6,8,10-11H,1,7H2,2-3H3/t8-,10+,11+/m0/s1 |
| InChIKey | DPEACQSCXDKNIR-JMJZKYOTSA-N |
| XLogP | 1.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|