About (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene
(4-tert-butylcyclohexa-1,4-dien-1-yl)benzene (PubChem CID 10798618) has the molecular formula C16H20
and a molecular weight of 212.34 g/mol. Its IUPAC name is (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene |
| PubChem CID | 10798618 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene |
| SMILES | CC(C)(C)C1=CCC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C16H20/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | OTJXWRLEMNASRF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene?
The IUPAC name of (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene (CID 10798618) is (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene.
What is the SMILES notation for (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene?
The canonical SMILES for (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene is CC(C)(C)C1=CCC(c2ccccc2)=CC1.
What is the InChIKey of (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene?
The InChIKey is OTJXWRLEMNASRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13/h4-9,12H,10-11H2,1-3H3.
What are the key properties of (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene?
(4-tert-butylcyclohexa-1,4-dien-1-yl)benzene has a molecular weight of 212.34 g/mol, XLogP of 4.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene is sourced from PubChem (CID 10798618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).