C16H20 — CID 10798618
(4-tert-butylcyclohexa-1,4-dien-1-yl)benzene (PubChem CID 10798618) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene.
| Compound Name | (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 10798618 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (4-tert-butylcyclohexa-1,4-dien-1-yl)benzene |
| SMILES | CC(C)(C)C1=CCC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C16H20/c1-16(2,3)15-11-9-14(10-12-15)13-7-5-4-6-8-13/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | OTJXWRLEMNASRF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|